Biotin
Biotin, also known as vitamin B7, is necessary for cell growth and production of fatty acids. It can be used to elute proteins from avidin-streptavidin resins.
| Trivial name | Vitamin B7 |
| Catalog Number | CSN23623 |
| Alternative Name(s) | Vitamin B7 |
| Research Area | / |
| Molecular Formula | C10H16N2O3S |
| CAS# | 58-85-5 |
| Purity | ≥98% |
| SMILES | O=C(O)CCCC[C@@H]1SC[C@]([C@]1([H])N2)([H])NC2=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/biotin.html |