Cephalothin sodium
Cephalothin (Cefalotin, Cephalotin) sodium is a semisynthetic, beta-lactam, first-generation cephalosporin antibiotic with bactericidal activity. Cephalothin binds to and inactivates penicillin-binding proteins (PBP) located on the inner membrane of the bacterial cell wall.
| Trivial name | Cefalotin sodium, Sodium cephalotin |
| Catalog Number | S4594 |
| Molecular Formula | C16H18N6O |
| CAS# | 58-71-9 |
| SMILES | CC1CN(C12CCN(C2)C3=NC=NC4=C3C=CN4)C(=O)CC#N |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/cephalothin.html |
| Additional Information | https://file.selleck.cn/downloads/struct/cephalothin-chemical-structure-s4594.gif |