Adenosine
API Standard
| Catalog Number | CS-O-00884 |
| Alternative Name(s) | 2-(6-amino-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol;CS-O-30526 |
| Research Area | Adenosine is a ribonucleoside comprised of adenine bound to ribose, with vasodilatory, antiarrhythmic and analgesic activities. Phosphorylated forms of adenosine play roles in cellular energy transfer, signal transduction and the synthesis of RNA. |
| Molecular Formula | C10H13N5O4 |
| CAS# | 58-61-7 |
| Purity | >98% |
| SMILES | O[C@H]([C@@H]1O)[C@@H](O[C@@H]1CO)N2C3=NC=NC(N)=C3N=C2 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00884.html |