Theophylline
Theophylline is a dimethylxanthine having the two methyl groups located at positions 1 and 3. It is structurally similar to caffeine and is found in green and black tea. It has a role as a vasodilator agent, a bronchodilator agent, a muscle relaxant, an EC 3.1.4.* (phosphoric diester hydrolase) inhibitor, an anti-asthmatic drug, an anti-inflammatory agent, an immunomodulator, an adenosine receptor antagonist, a drug metabolite, a fungal metabolite and a human blood serum metabolite.
Catalog Number | PIPE-0780 |
Alternative Name(s) | 1,3-Dimethylxanthine Elixophyllin Theophylline anhydrous |
Research Area | Natural Extract |
Molecular Formula | C7H8N4O2 |
CAS# | 58-55-9 |
SMILES | CN1C2=C(C(=O)N(C1=O)C)NC=N2 |
Size | inquiry |
Supplier Page | https://www.protheragen-ing.com/theophylline-item-9719.html |