Tetrabenazine (Xenazine)
Tetrabenazine(Xenazine,Ro 1-9569) acts primarily as a reversible high-affinity inhibitor of mono-amine uptake into granular vesicles of presynaptic neurons by binding selectively to VMAT-2; Also blocks dopamine D2 receptors, but this affinity is 1,000-fold lower than its affinity for VMAT-2.
| Trivial name | Xenazine,Ro 1-9569 |
| Catalog Number | S1789 |
| Molecular Formula | C22 H27 Cl F N7 O4 S |
| CAS# | 58-46-8 |
| Inchi | InChI=1S/C22H27ClFN7O4S/c1-12(2)31-11-16(17-6-7-25-21(28-17)26-10-13(3)27-22(32)35-4)20(29-31)15-8-14(23)9-18(19(15)24)30-36(5,33)34/h6-9,11-13,30H,10H2,1-5H3,(H,27,32)(H,25,26,28)/t13-/m0/s1 |
| Inchi Key | CMJCXYNUCSMDBY-ZDUSSCGKSA-N |
| SMILES | CC(C)N1C=C(C(=N1)C2=C(C(=CC(=C2)Cl)NS(=O)(=O)C)F)C3=NC(=NC=C3)NCC(C)NC(=O)OC |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/Tetrabenazine(Nitoman).html |
| Additional Information | https://file.selleck.cn/downloads/struct/tetrabenazine-nitoman-xenazine-chemical-structure-s1789.gif |
