Tetrabenazine (Xenazine)
Tetrabenazine(Xenazine,Ro 1-9569) acts primarily as a reversible high-affinity inhibitor of mono-amine uptake into granular vesicles of presynaptic neurons by binding selectively to VMAT-2; Also blocks dopamine D2 receptors, but this affinity is 1,000-fold lower than its affinity for VMAT-2.
| Trivial name | Xenazine,Ro 1-9569 |
| Catalog Number | S1789 |
| Molecular Formula | C24H25ClN6O |
| CAS# | 58-46-8 |
| Inchi | InChI=1S/C24H25ClN6O/c1-32-22-12-16(31-10-8-15(26)9-11-31)6-7-21(22)29-24-28-14-19(25)23(30-24)18-13-27-20-5-3-2-4-17(18)20/h2-7,12-15,27H,8-11,26H2,1H3,(H,28,29,30) |
| Inchi Key | GCYIGMXOIWJGBU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCC(CC2)N)NC3=NC=C(C(=N3)C4=CNC5=CC=CC=C54)Cl |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/Tetrabenazine(Nitoman).html |
| Additional Information | https://file.selleck.cn/downloads/struct/tetrabenazine-nitoman-xenazine-chemical-structure-s1789.gif |
