Tetrabenazine
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30799 |
| Alternative Name(s) | ((3R,11bR)-rel-1,3,4,6,7,11b-Hexahydro-9,10-dimethoxy-3-(2-methylpropyl)-2H-benzo[a]quinolizin-2-one) ; |
| Research Area | A drug formerly used as an antipsychotic and treatment of various movement disorders. Tetrabenazine blocks neurotransmitter uptake into adrenergic storage vesicles and has been used as a high affinity label for the vesicle transport system.A drug formerly |
| Molecular Formula | C19H27NO3 |
| CAS# | 58-46-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | COC1=CC([C@@](C2)([H])N3C[C@H](CC(C)C)C2=O)=C(CC3)C=C1OC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30799.html |
| Additional Information | NULL |