(+)-5-trans Cloprostenol | MedChemExpress (MCE)
Cloprostol, a synthetic derivative of prostaglandin F2α, is used as an ossified in veterinary medicine and the research of reproductive disorders in cattle, pigs and horses. (+)-5-trans Cloprostenol is a secondary impurity produced during the synthesis of (+) -cloprostenol[1].
| Trivial name | (+)-5-trans Cloprostenol |
| Catalog Number | HY-120955 |
| Research Area | Others |
| CAS# | 57968-81-7 |
| Purity | ≥98.00% |
| SMILES | OC(CCC/C=C/C[C@@H]1[C@H]([C@H](O)C[C@@H]1O)/C=C/[C@@H](O)COC2=CC(Cl)=CC=C2)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/plus-5-trans-cloprostenol.html |