GW809897X | MedChemExpress (MCE)
GW809897X is a dual inhibitor of Fluc and VEGFR with IC50 of 0.58 μM and 65 nM, respectively. GW809897X is a protein kinase inhibitor across ATP-dependent and -independent luciferases with potential impact on Fluc reporter assays[1].
| Trivial name | GW809897X |
| Catalog Number | HY-160685 |
| Research Area | Others |
| CAS# | 579515-94-9 |
| Purity | ≥98.0% |
| SMILES | CN(C1=CC=C(NC(NC2=C(Cl)C=CC=C2Cl)=O)C=C1)C3=NC(NC4=CC(C[S+]([O-])(C)=O)=CC=C4)=NC=C3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/gw809897x.html |