MCF | MedChemExpress (MCE)
MCF is an antimicrobial peptide derived from bee venom. MCF has activity against E.coli W 160-37, S.aureus 8530 and B.subtilis, the MIC values are 35-45 μg/ml, 25-35 μg/ml and 15-25 μg/ml[1].
| Trivial name | MCF |
| Catalog Number | HY-P5629 |
| Research Area | Infection |
| CAS# | 579474-25-2 |
| Purity | ≥98.00% |
| SMILES | O=C(N[C@@H](CC(C)C)C(N1[C@@H](CCC1)C(N[C@@H](C)C(N[C@@H](CC(C)C)C(N[C@@H]([C@@H](C)CC)C(N[C@@H](CO)C(N[C@@H](CC2=CNC3=CC=CC=C23)C(N[C@@H]([C@@H](C)CC)C(N[C@@H](CCCCN)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCCN)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCC(N)=O)C(N[C@@H](CCC(N)=O)C(NCC(N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)CN |
| PubChem Chemical Structure ID | 16142302 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mcf.html |