L(+)-Asparagine monohydrate
L-asparagine is a non-essential amino acid that is involved in the metabolic control of cell functions in nerve and brain tissue, being used for a variety of pharmaceutical applications.
| Trivial name | N/A |
| Catalog Number | S4950 |
| Molecular Formula | C22H27N3O3S |
| CAS# | 5794-13-8 |
| SMILES | CN1C2=C(C=C(C=C2)C3=CN=CS3)C(=CC1=O)NC4CCC(CC4)OCCOC |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/l-asparagine-monohydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s4950-l-asparagine-monohydrate-chemical-structure-.gif |