Cyclovalone | MedChemExpress (MCE)
Cyclovalone (Beveno) is a synthetic curcumin derivate, which inihibits cyclooxygenase and exhibits anti-inflammatory, antitumor and antioxidant activities[1]. Cyclovalone inhibits cell proliferation in normal and malignant prostatic cells. Cyclovalone ist orally active[2].
| Trivial name | Cyclovalone |
| Catalog Number | HY-107336 |
| Alternative Name(s) | Beveno |
| Research Area | Inflammation/Immunology |
| CAS# | 579-23-7 |
| Purity | ≥98.0% |
| SMILES | O=C(/C(CCC/1)=C/C2=CC(OC)=C(O)C=C2)C1=C\C3=CC(OC)=C(O)C=C3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cyclovalone.html |