Idarubicin HCl
Idarubicin HCl (4-demethoxydaunorubicin (NSC256439, 4-DMDR) HCl) is a hydrochloride salt form of Idarubicin which is an anthracycline antibiotic and a DNA topoisomerase II (topo II) inhibitor for MCF-7 cells with IC50 of 3.3 ng/mL in a cell-free assay. Idarubicin induces mTOR-dependent cytotoxic autophagy.
| Trivial name | 4-demethoxydaunorubicin (NSC256439, 4-DMDR) HCl |
| Catalog Number | S1228 |
| Molecular Formula | C₁₇H₁₅Cl₃N₄ |
| CAS# | 57852-57-0 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | Cl.Cl.ClC1=CC=CC(=C1)C([N]2C=CN=C2)C3=CC4=C(C=C3)N=C[NH]4 |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/Idarubicin.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Idarubicin-HCl-chemical-structure-S1228.gif |