Idarubicin HCl 10mM * 1mL in DMSO
Idarubicin is an anthracycline antibiotic that is an anti-leukemia agent with higher DNA binding capacity and greater cytotoxicity than daunorubicin.
| Trivial name | Idarubicin HCl 10mM * 1mL in DMSO |
| Catalog Number | A10465-10mM-D |
| Alternative Name(s) | (7S-cis)-9-Acetyl-7-[(3-amino-2,3,6-trideoxy-??-L-lyxo-hexopyranosyl)oxy]-7,8,9,10-tetrahydro-6,9,11-trihydroxy-5,12-naphthacenedione |
| Molecular Formula | C26H28ClNO9 |
| CAS# | 57852-57-0 |
| SMILES | C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C(C4=C(C(=C23)O)C(=O)C5=CC=CC=C5C4=O)O)(C(=O)C)O)N)O.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/idarubicin-hcl.html |
