Domperidone
API Standard
| Trivial name | NULL |
| Catalog Number | CS-T-21290 |
| Alternative Name(s) | 5-chloro-1-{1-[3-(2-oxo-2,3-dihydro-1H-1,3- benzodiazol-1-yl)propyl]piperidin-4-yl}-2,3- dihydro-1H-1,3-benzodiazol-2-one |
| Research Area | A novel peripheral dopamine receptor antagonist that does not cross the blood-brain barrier; anti-emetic. Domperidone(Motilium) is a dopamine blocker and an antidopaminergic reagent. |
| Molecular Formula | C22H24ClN5O2 |
| CAS# | 57808-66-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1N(C2CCN(CCCN3C(C=CC=C4)=C4NC3=O)CC2)C(C=CC(Cl)=C5)=C5N1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST21290.html |
| Additional Information | NULL |