(±)-Aiphanol | MedChemExpress (MCE)
(±)-Aiphanol is a newly discovered stilbenolignan analog. (±)-Aiphanol exhibits significant anti-inflammatory activity, acting through inhibition of COX-1 and COX-2. The inhibitory effect on COX-1 (IC50 = 1.9 μM) is particularly strong, while the effect on COX-2 (IC50= 9.9 μM) is relatively weak[1].(±)-Aiphanol effectively inhibits VEGFR2 (IC50=0.92 µM). (±)-Aiphanol blocks angiogenesis and promotes apoptosis through inhibition of VEGFR2 and COX2 activity. (±)-Aiphanol is orally active[2].
| Trivial name | (±)-Aiphanol |
| Catalog Number | HY-152120 |
| Alternative Name(s) | Aiphanol |
| Research Area | Inflammation/Immunology; Cancer |
| CAS# | 578020-29-8 |
| Purity | ≥98.0% |
| SMILES | OC[C@@H]1[C@@H](C2=CC(OC)=C(C(OC)=C2)O)OC3=CC(/C=C/C4=CC(O)=CC(O)=C4)=CC=C3O1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/racemic-aiphanol.html |
