Liquiritigenin
Liquiritigenin is an estrogenic compound which fuctions as a selective agonist of the estrogen receptor ERβ and an partial agonist of ERα. It also has choleretic effect. Liquiritigenin is a flavanone extracted from glycyrrhiza uralensis with antitumour action.
| Trivial name | 4',7-Dihydroxyflavanone |
| Catalog Number | CSN12274 |
| Alternative Name(s) | 4',7-Dihydroxyflavanone |
| Research Area | / |
| Molecular Formula | C15H12O4 |
| CAS# | 578-86-9 |
| Purity | ≥98% |
| SMILES | O=C1C[C@@H](C2=CC=C(O)C=C2)OC3=C1C=CC(O)=C3 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/liquiritigenin.html |