Ledol | MedChemExpress (MCE)
Ledol ((+)-Ledol) is an antifungal agent that can be isolated from the essential oil fractions of Rhododendron tomentosum. Ledol is also the expectorant and antitussive agent, which is simultaneously responsible for adverse reactions such as dizziness, nausea and vomiting[1].
| Trivial name | Ledol |
| Catalog Number | HY-121388 |
| Alternative Name(s) | (+)-Ledol |
| Research Area | Infection |
| CAS# | 577-27-5 |
| Purity | ≥98.00% |
| SMILES | O[C@@]1(C)CC[C@@]2([H])[C@@](C2(C)C)([H])[C@@]3([H])[C@@H](C)CC[C@@]13[H] |
| PubChem Chemical Structure ID | 11074994 |
| Size | 25 mg |
| Supplier Page | https://www.medchemexpress.com/ledol.html |