Kanosamine HCl
Kanosamine HCl is an antibiotic which inhibits the growth of plant-pathogenic oomycetes, certain fungi and a few bacterial species. Kanosamine inhibits Phytophthora medicaginis M2913 and Aphanomyces euteiches WI-98 with MICs of 25 and 60 µg/mL, respectively.
| Trivial name | / |
| Catalog Number | CSN21190 |
| Alternative Name(s) | / |
| Research Area | Infection |
| Molecular Formula | C6H14ClNO5 |
| CAS# | 57649-10-2 |
| Purity | ≥98% |
| SMILES | O=C[C@@H]([C@@H](N)[C@@H]([C@@H](CO)O)O)O.[H]Cl |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/kanosamine-hcl.html |