α-Cembrenediol | MedChemExpress (MCE)
α-Cembrenediol is a potent inhibitor of EBV.α-Cembrenediol inhibits the early antigen of the Epstein-Bar virus. α-Cembrenediol also has anti-tumour activity[1].
| Trivial name | α-Cembrenediol |
| Catalog Number | HY-N8459 |
| Alternative Name(s) | α-CBD |
| Research Area | Cancer |
| CAS# | 57605-80-8 |
| Purity | ≥98.00% |
| SMILES | O[C@@]1(C)C[C@@H](O)/C=C(C)/CC/C=C(C)/CC[C@@H](C(C)C)/C=C/1 |
| PubChem Chemical Structure ID | 11109567 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-cembrenediol.html |