Ibuprofen Lysinate
API Standards
| Trivial name | NULL |
| Catalog Number | CS-EL-00119 |
| Alternative Name(s) | 57469-76-8; L-Lysine Mono[α-methyl-4-(2-methylpropyl)benzeneacetate]; α-Methyl-4-(2-methylpropyl)benzeneacetic Acid Compd. With L-Lysine (1:1); Arfen; Dolormin; Ibuprofen Lysine; Ibuprofen Lysine Salt; Imbun; Imbun 500; Lisiprofen; Lysine 2-(p-Isobutylphenyl)propionate; Saren; Solufenum; Soluphene |
| Research Area | Ibuprofen Lysinate is used in the treatment of hemodynamically significant patent ductus arteriosus in neonates greater than 27 week gestational age. |
| Molecular Formula | C19H32N2O4 |
| CAS# | 57469-77-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(CC1=CC=C(C(C(O)=O)C)C=C1)C.N[C@H](C(O)=O)CCCCN |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSEL00119.html |
| Additional Information | NULL |