Nε-(Carboxymethyl)-L-lysine | MedChemExpress (MCE)
Nε-(Carboxymethyl)-L-lysine (CML) is a unique post-translational modification (PTM) of proteins that is generated by the non-enzymatic glycation of lysine residues. Nε-(Carboxymethyl)-L-lysine is a relatively recently discovered modification, and has been found to be a major component of the advanced glycation endproducts (AGEs) found in multiple human diseases, such as diabetes, Alzheimer’s disease, and cancer[1].
| Trivial name | Nε-(Carboxymethyl)-L-lysine |
| Catalog Number | HY-W286743 |
| Alternative Name(s) | CML; N6-(Carboxymethyl)-L-lysine; Nε-(1-Carboxymethyl)-L-lysine |
| Research Area | Metabolic Disease; Cardiovascular Disease; Cancer |
| CAS# | 5746-04-3 |
| Purity | ≥98.0% |
| SMILES | C(CCNCC(=O)O)C[C@@H](C(=O)O)N |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/nε-carboxymethyl-l-lysine.html |