Isochlorogenic Acid C
Isochlorogenic acid C, a natural product isolated and purified from the herbs of Laggera alata, possesses potent hepatoprotective and anti-HBV, anti-HCV, and anti-HIV effects.
| Trivial name | 4,5-Dicaffeoylquinic Acid; 4,5-DCQA; Isochlorogenic Acid C(4,5) |
| Catalog Number | CSN12804 |
| Alternative Name(s) | 4,5-Dicaffeoylquinic Acid; 4,5-DCQA; Isochlorogenic Acid C(4,5) |
| Research Area | Infection |
| Molecular Formula | C25H24O12 |
| CAS# | 57378-72-0 |
| Purity | ≥95% |
| SMILES | O=C([C@]1(O)C[C@@H](OC(/C=C/C2=CC=C(O)C(O)=C2)=O)[C@@H](OC(/C=C/C3=CC=C(O)C(O)=C3)=O)[C@H](O)C1)O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/isochlorogenic-acid-c.html |