Tacalcitol
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-02486 |
| Alternative Name(s) | (1R,3S,Z)-5-((E)-2-((1R,3aS,7aR)-1-((2R,5R)-5-hydroxy-6-methylheptan-2-yl)-7a-methylhexahydro-1H-inden-4(2H)-ylidene)ethylidene)-4-methylenecyclohexane-1,3-diol |
| Research Area | Tacalcitol for the treatment of psoriasis, chronic chapped lips and other severe dry skin conditions because of its ability to reduce excessive skin cell turnover. |
| Molecular Formula | C27H44O3 |
| CAS# | 57333-96-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@]([C@@]1([H])[C@H](C)CC[C@@H](O)C(C)C)(CCC/2)[C@](CC1)([H])C2=CC=C(C[C@@H](O)C[C@@H]3O)/C3=C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02486.html |
| Additional Information | NULL |
