Ridaforolimus (Deforolimus, MK-8669)
Ridaforolimus (Deforolimus, MK-8669, AP23573) is a selective mTOR inhibitor with IC50 of 0.2 nM in HT-1080 cell line; while not classified as a prodrug, mTOR inhibition and FKBP12 binding is similar to rapamycin. Phase 3.
| Trivial name | AP23573 |
| Catalog Number | S1022 |
| Molecular Formula | C22H26N2O9 |
| CAS# | 572924-54-0 |
| Inchi | InChI=1S/C22H24N2O8.H2O/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29;/h4-7,10,14-15,17,25,27-29,32H,1-3H3,(H2,23,31);1H2/t7-,10+,14+,15-,17-,22-;/m 0./s1 |
| Inchi Key | XQTWDDCIUJNLTR-CVHRZJFOSA-N |
| SMILES | CC1C2C(C3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O.O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/Deforolimus.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Deforolimus-Ridaforolimus-chemical-structure-S1022.gif |
