Deforolimus (Ridaforolimus) 10mM * 1mL in DMSO
Deforolimus (Ridaforolimus) is an investigational targeted and small-molecule inhibitor of the protein mTOR, a protein that acts as a central regulator of protein synthesis, cell proliferation, cell cycle progression and cell survival, integrating signals from proteins, such as PI3K, AKT and PTEN known to be important to malignancy. Blocking mTOR creates a starvation-like effect in cancer cells by interfering with cell growth, division, metabolism, and angiogenesis.
| Trivial name | Deforolimus (Ridaforolimus) 10mM * 1mL in DMSO |
| Catalog Number | A10295-10mM-D |
| Alternative Name(s) | 42-(Dimethylphosphinate)rapamycin |
| Molecular Formula | C53H84NO14P |
| CAS# | 572924-54-0 |
| SMILES | C[C@@H]1CC[C@H]2C[C@@H](/C(=C/C=C/C=C/[C@H](C[C@H](C(=O)[C@@H]([C@@H](/C(=C/[C@H](C(=O)C[C@H](OC(=O)[C@@H]3CCCCN3C(=O)C(=O)[C@@]1(O2)O)[C@H](C)C[C@@H]4CC[C@H]([C@@H](C4)OC)OP(=O)(C)C)C)/C)O)OC)C)C)/C)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/deforolimus-ridaforolimus.html |
