Calmidazolium chloride
Calmidazolium chloride (R 24571) is a calmodulin (CaM) antagonist, antagonizing CaM-stimulated fraction of rat brain phosphodiesterase and CaM-induced activation of erythrocyte Ca2+-transporting ATPase with IC50s of 0.15 and 0.35 μM, respectively, also shows a CaM-binding Kd value of 3 nM.
| Trivial name | R 24571 |
| Catalog Number | E0483 |
| Molecular Formula | C31H23Cl6N2O.Cl |
| CAS# | 57265-65-3 |
| SMILES | [Cl-].ClC1=CC=C(C=C1)C([N]2C=C[N+](=C2)CC(OCC3=CC=C(Cl)C=C3Cl)C4=C(Cl)C=C(Cl)C=C4)C5=CC=C(Cl)C=C5 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/calmidazolium-chloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0483-calmidazolium-chloride-chemical-structure.gif |