Ayanin
Ayanin, a natural product isolated and purified from the rhizomes of Curcuma aromatica, with vasorelaxant activity and may have the potential for use in treating allergic asthma. Its IC(50) value 2.2mM for inhibiting interleukin (IL)-4 production from purified basophils.
| Trivial name | / |
| Catalog Number | CSN14111 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C18H16O7 |
| CAS# | 572-32-7 |
| Purity | ≥98% |
| SMILES | O=C1C(OC)=C(C2=CC=C(OC)C(O)=C2)OC3=CC(OC)=CC(O)=C13 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/ayanin.html |