6-keto estradiol
A derivative of Estradiol. Estradiol​ is the major estrogen secreted by the premenopausal ovary. Estrogens direct the development of the female genotype in embryogenesis and at puberty.
| Catalog Number | INT571926 |
| Alternative Name(s) | 6-Ketoestradiol 6-Oxoestradiol 6-Keto 17|A-Estradiol |
| Research Area | Intermediates |
| Molecular Formula | C18H22O3 |
| CAS# | 571-92-6 |
| SMILES | CC12CCC3C(C1CCC2O)CC(=O)C4=C3C=CC(=C4)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/6-keto-estradiol-item-11423.html |