(±)-Sulfinpyrazone
(±)-Sulfinpyrazone is one of the most studied platelet COX inhibitors, also a uricosuric agent that competitively inhibits uric acid reabsorption in kidney proximal tubules.
| Trivial name | G-28315; NSC 75925 |
| Catalog Number | CSN16856 |
| Alternative Name(s) | G-28315; NSC 75925 |
| Research Area | / |
| Molecular Formula | C23H20N2O3S |
| CAS# | 57-96-5 |
| Purity | ≥98% |
| SMILES | O=C(C1CCS(C2=CC=CC=C2)=O)N(C3=CC=CC=C3)N(C4=CC=CC=C4)C1=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/(±)-sulfinpyrazone.html |