It has a role as an osmolyte, a sweetening agent, a human metabolite, an algal metabolite, a Saccharomyces cerevisiae metabolite, an Escherichia coli metabolite and a mouse metabolite.
| Catalog Number | PIPB-0124 |
| Alternative Name(s) | saccharose sugar Table sugar |
| Research Area | Sugar Alcohols |
| Molecular Formula | C12H22O11 |
| CAS# | 57-50-1 |
| SMILES | C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/sucrose-item-10242.html |
Sucrose is a glycosyl glycoside formed by glucose and fructose units joined by an acetal oxygen bridge from hemiacetal of glucose to the hemiketal of the fructose. It has a role as an osmolyte, a sweetening agent, a human metabolite, an algal metabolite, a Saccharomyces cerevisiae metabolite, an Escherichia coli metabolite and a mouse metabolite.
| Catalog Number | PIPE-0787 |
| Alternative Name(s) | saccharose sugar Table sugar |
| Research Area | Natural Extract |
| Molecular Formula | C12H22O11 |
| CAS# | 57-50-1 |
| Purity | 0.98% |
| SMILES | C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/sucrose-item-9726.html |
