Urea
Urea (Carbonyldiamide, Ureophil) is a highly soluble organic compound formed in the liver from ammonia produced by the deamination of amino acids. It is the principal end product of protein catabolism and constitutes about one half of the total urinary solids.
| Trivial name | Carbonyldiamide, Ureophil |
| Catalog Number | S3687 |
| Molecular Formula | C22H21ClN4O4 |
| CAS# | 57-13-6 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CC1=C(Cl)C=C(NC(=O)NCC2=CC3=C(C=C2)C(=O)N(C3)C4CCC(=O)NC4=O)C=C1 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/urea.html |
| Additional Information | https://file.selleck.cn/downloads/struct/urea-chemical-structure-s3687.gif |