Stearic acid
Stearic acid (Octadecanoic acid, Isostearic acid, Cetylacetic acid) is a natural saturated fatty acid found in animal and vegetable fats. It could be used as a food additive and used in soaps, cosmetics and detergents.
| Trivial name | Octadecanoic acid, Isostearic acid, Cetylacetic acid |
| Catalog Number | S5733 |
| Molecular Formula | C23H25N9O |
| CAS# | 57-11-4 |
| SMILES | NC1=CN=CC(=N1)C2=C[N]3C=CN=C3C(=N2)NC4=CC=C(C=C4)N5CCN(CC5)C6COC6 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/stearic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/stearic-acid-chemical-structure-s5733.gif |
