Creatine
Creatine (Methylguanidoacetic acid) is a nitrogenous organic acid that occurs naturally in vertebrates. It facilitates the recycling of adenosine triphosphate (ATP) primarily in muscle and brain tissue.Creatine can inhibits the JAK-STAT1 signal transmission by inhibiting the interaction of IFN-γ receptors with JAK2 in an ATP-independent manner, thereby inhibiting downstream pro-inflammatory gene expression.
| Trivial name | Methylguanidoacetic acid |
| Catalog Number | S5588 |
| Molecular Formula | C20H19N3O3 |
| CAS# | 57-00-1 |
| SMILES | COC1=C(C=CC=C1)C2=N[N]3CC4=CC=C(NC(C)=O)C=C4OCC3=C2 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/creatine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/creatine-chemical-structure-s5588.gif |
