NSC 87877
NSC 87877 is a cell-permeable inhibitor of both SHP-1 and SHP-2 with IC50 values of 355 and 318 nM respectively. It also inhibits EGF-induced Erk1/2 activation in HEK293 cells and significantly reduces MDA-MB-468 cell viability/proliferation.
| Trivial name | / |
| Catalog Number | CSN10182 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C19H11N3Na2O7S2 |
| CAS# | 56932-43-5 |
| Purity | ≥96% |
| SMILES | O=S(C1=C2C=CC=NC2=C(O)C(/N=N/C3=CC=C4C=C(S(=O)([O-])=O)C=CC4=C3)=C1)([O-])=O.[Na+].[Na+] |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/nsc-87877.html |