Tanshinone I 10mM * 1mL in DMSO
Tanshinones are the major bioactive compounds of Salvia miltiorrhiza Bunge (Danshen) roots, which are used in many therapeutic remedies in Chinese traditional medicine.
| Trivial name | Tanshinone I 10mM * 1mL in DMSO |
| Catalog Number | A10889-10mM-D |
| Alternative Name(s) | 1,6-Dimethyl-phenanthro[1,2-b]furan-10,11-dione |
| Molecular Formula | C18H12O3 |
| CAS# | 568-73-0 |
| SMILES | CC1=CC=CC2=C1C=CC3=C2C(=O)C(=O)C4=C3OC=C4C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tanshinone-i.html |