Tanshinone IIA
Tanshinone IIA (Tanshinone B) is the most abundant diterpene quinone in Danshen, Salviae miltiorrhizae Radix, a widely prescribed traditional herbal medicine that is used to treat cardiovascular and inflammatory diseases; A natural monoacylglycerol lipase inhibitor.
| Trivial name | Tanshinone B |
| Catalog Number | S2365 |
| Molecular Formula | C19H18O3 |
| CAS# | 568-72-9 |
| Inchi | InChI=1S/C19H18O3/c1-10-9-22-18-12-6-7-13-11(5-4-8-19(13,2)3)15(12)17(21)16(20)14(10)18/h6-7,9H,4-5,8H2,1-3H3 |
| Inchi Key | HYXITZLLTYIPOF-UHFFFAOYSA-N |
| SMILES | CC1=COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)C |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/Tanshinone-IIA(Tanshinone-B).html |
| Additional Information | https://file.selleck.cn/downloads/struct/Tanshinone-IIA-Tanshinone-B-chemical-structure-S2365.gif |