Cefmetazole Sodium
Cefmetazole Sodium is a cephamycin antibiotic as a second-generation cephalosporins with a broad spectrum of activity against both gram-positive and gram-negative microorganisms.
| Trivial name | Sodium Cefmetazole |
| Catalog Number | CSN10573 |
| Alternative Name(s) | Sodium Cefmetazole |
| Research Area | Infection |
| Molecular Formula | C15H16N7NaO5S3 |
| CAS# | 56796-39-5 |
| Purity | ≥98% |
| SMILES | O=C(C(N12)=C(CSC3=NN=NN3C)CS[C@]2([H])[C@](OC)(NC(CSCC#N)=O)C1=O)[O-].[Na+] |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/cefmetazole-sodium.html |