BHPI
BHPI is a potent inhibitor of nuclear estrogen–ERα-regulated gene expression and elicits sustained ERα-dependent activation of the endoplasmic reticulum (EnR) stress sensor, the unfolded protein response (UPR), and persistent inhibition of protein synthesis.
| Trivial name | / |
| Catalog Number | CSN18336 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C21H17NO3 |
| CAS# | 56632-39-4 |
| Purity | ≥98% |
| SMILES | O=C1NC2=C(C=CC=C2C)C1(C3=CC=C(O)C=C3)C4=CC=C(O)C=C4 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/bhpi.html |