C7BzO | MedChemExpress (MCE)
C7BzO (Dimethyl-2-hydroxyethylampropanepropanesulfonate) is a potent solubilizing detergent that can be used for samples such as bacteria, mammals, and plants. C7BzO can be used for the extraction of proteins and the preparation of two-dimensional gel electrophoresis samples[1].
| Trivial name | C7BzO |
| Catalog Number | HY-157883 |
| Alternative Name(s) | Dimethyl-2-hydroxyethylampropanepropanesulfonate |
| Research Area | Others |
| CAS# | 565454-39-9 |
| Purity | ≥98.0% |
| SMILES | O=S([O-])(CCC[N+](C)(CCC(C1=CC=C(CCCCCCC)C=C1)O)C)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/c7bzo.html |