γ-Glutamylornithine | MedChemExpress (MCE)
γ-Glutamylornithine is the urine excreta of patients with HHH syndrome (hyperuricemia, hyperaminemia, and hypercitrullinuria) and rotary atrophy associated with hyperuricemia. Increased levels of endogenous ornithine increase levels of γ-Glutamylornithine in the urine[1].
| Trivial name | γ-Glutamylornithine |
| Catalog Number | HY-N8063 |
| Research Area | Others |
| CAS# | 56523-61-6 |
| Purity | ≥98.00% |
| SMILES | OC([C@H](CCCN)NC(CC[C@H](N)C(O)=O)=O)=O |
| PubChem Chemical Structure ID | 20849164 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/γ-glutamylornithine.html |