Glutaurine
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-O-16311 |
| Alternative Name(s) | (S)-2-amino-5-oxo-5-((2-sulfoethyl)amino)pentanoic acid |
| Research Area | Glutaurine has been observed to display antiepileptic effects with anti-amnesia properties. Mimics anxiolytic drug Diazepam (D416855). |
| Molecular Formula | C7H14N2O6S |
| CAS# | 56488-60-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(NCC[S](=O)(O)=O)CC[C@H](N)C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16311.html |
| Additional Information | NULL |