A-26771B | MedChemExpress (MCE)
A-26771B is an antibiotic can be obtained from Penicillium turbatum. A-26771B exhibits moderate antimicrobial activity against Gram-positive bacteria, mycoplasma, and fungi. A-26771B also inhibits potassium-dependent ATPase in rat liver mitochondria[1].
| Trivial name | A-26771B |
| Catalog Number | HY-122076 |
| Research Area | Infection |
| CAS# | 56448-20-5 |
| Purity | ≥98.0% |
| SMILES | OC(CCC(O[C@@H]1C(/C=C/C(O[C@@H](CCCCCCCCC1)C)=O)=O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/a-26771b.html |