Epirubicin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01481 |
| Alternative Name(s) | (8S,10S)-10-(((2R,4S,5R,6S)-4-amino-5-hydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)-6,8,11-trihydroxy-8-(2-hydroxyacetyl)-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione |
| Research Area | Epirubicin Base is a 4'-epi-isomer of the anthracycline antineoplastic antibiotic doxorubicin. Epirubicin intercalates into DNA and inhibits topoisomerase II, thereby inhibiting DNA replication and ultimately, interfering with RNA and protein synthesis. T |
| Molecular Formula | C27H29NO11 |
| CAS# | 56420-45-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC1=C(C[C@](C(CO)=O)(O)C[C@@H]2O[C@@](O[C@@H](C)[C@@H]3O)([H])C[C@@H]3N)C2=C(O)C(C4=O)=C1C(C5=CC=CC(OC)=C45)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01481.html |
| Additional Information | NULL |