Doxycycline D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-15701 |
| Alternative Name(s) | (4R,4aR,5S,5aR,6S,12aS)‐4‐(dimethylamino)‐ 3,5,10,12,12a‐pentahydroxy‐6‐(D)methyl‐1,11‐ dioxo‐1,4,4a,5,5a,6,11,12a‐octahydro(4,6‐ D2)tetracene‐2‐carboxamide. |
| Research Area | Labeled Doxycycline, intended for use as an internal standard for the quantification of Doxycycline by GC- or LC-mass spectrometry. |
| Molecular Formula | C22H21D3N2O8 |
| CAS# | 564-25-0 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@](C(O)=C(C(C1=C2C=CC=C1O)=O)[C@]([C@@]2([2H])C[2H])([H])[C@@H]3O)(C(C(C(N)=O)=C4O)=O)[C@]3([H])[C@@H]4N(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15701.html |
| Additional Information | NULL |