Nosiheptide
Nosiheptide (Multhiomycin), a thiopeptide antibiotic produced by Streptomyces actuosus, inhibits bacterial protein synthesis and bears a unique indole side ring system and regiospecific hydroxyl groups on the characteristic macrocyclic core. Nosiheptide has been widely used as a feed additive for animal growth.
| Trivial name | Multhiomycin; RP 9671 |
| Catalog Number | CSN27363 |
| Alternative Name(s) | Multhiomycin; RP 9671 |
| Research Area | / |
| Molecular Formula | C51H43N13O12S6 |
| CAS# | 56377-79-8 |
| Purity | ≥90% |
| SMILES | OC1=C(N=C(C2=C1)C3=CSC(C4NC(C5=CSC(C(NC(C6=CSC(/C(NC(C(NC(C7=CSC2=N7)=O)C(C)O)=O)=C\C)=N6)=O)CC(O)C(OCC8=C9C(C)=C(C(SC4)=O)NC9=CC=C8)=O)=N5)=O)=N3)C%10=NC(C(NC(C(N)=O)=C)=O)=CS%10 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/nosiheptide.html |