N-Acetyl-L-Carnosine
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-O-01984 |
| Alternative Name(s) | (2S)-2-(3-acetamidopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid |
| Research Area | N-Acetylcarnosine (NAC) is a naturally occurring compound chemically related to the dipeptide carnosine. The NAC molecular structure is identical to carnosine with the exception that it carries an additional acetyl group. The acetylation makes NAC more resistant to degradation by carnosinase, an enzyme that breaks down carnosine to its constituent amino acids, beta-alanine and histidine. |
| Molecular Formula | C11H16N4O4 |
| CAS# | 56353-15-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC([C@@H](NC(CCNC(C)=O)=O)CC1=CN=CN1)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01984.html |
| Additional Information | NULL |