4′,5,7-Trimethoxyflavone
4′,5,7-Trimethoxyflavone (5,7,4′-Trimethoxyflavone, TMF) is a flavonoid isolated from Kaempferia parviflora (KP) that induces apoptosis. 4′,5,7-Trimethoxyflavone increases sub-G1 phase, DNA fragmentation, annexin-V/PI staining and Bax/Bcl-xL ratio, activates caspase-3 and degrades poly (ADP-ribose) polymerase (PARP) protein.
| Trivial name | 5,7,4'-Trimethoxyflavone, TMF |
| Catalog Number | S0913 |
| Molecular Formula | C18H16O5 |
| CAS# | 5631-70-9 |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3OC)OC |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/4-5-7-trimethoxyflavone.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s0913-4-5-7-trimethoxyflavone-chemical-structure.gif |