Alpha Gpc
Alpha GPC powder is a natural choline compound found in the brain. It rapidly delivers choline to the brain across the blood–brain barrier.
Stimulation muscle cells and all cell membranes, counteracting the age-related decrease in phospholipid (PC) biosynthesis, so it can be used as a health supplement.
| Catalog Number | ABA-091 |
| Alternative Name(s) | Alpha-GPC choline glycerophosphate |
| CAS# | 563-23-5 |
| SMILES | O=P(OCC[N+](C)(C)C)(OCC(O)CO)O.[OH-] |
| Size | Inquiry |
| Supplier Page | https://www.agingclocks.com/alpha-gpc-item-1960.html |