Securinine
Securinine, a natural product isolated and purified from the leaves and twigs of Securinega suffruticosa with antifungal activity, induces apoptosis in human leukemia HL-60 cells, is a promising monocytic differentiation inducing agent for Acute Myeloid Leukemia (AML).
| Trivial name | / |
| Catalog Number | CSN11911 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C13H15NO2 |
| CAS# | 5610-40-2 |
| Purity | ≥95% |
| SMILES | O=C(O1)C=C2[C@@]13[C@](CCCC4)([H])N4[C@](C3)([H])C=C2 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/securinine.html |